C24H30N4O4 — CID 139212958
4-(3-but-3-enyl-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl)-N-methyl-3-nitro-N-propylbenzamide (PubChem CID 139212958) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-(3-but-3-enyl-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl)-N-methyl-3-nitro-N-propylbenzamide.
| Compound Name | 4-(3-but-3-enyl-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl)-N-methyl-3-nitro-N-propylbenzamide |
|---|---|
| PubChem CID | 139212958 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 4-(3-but-3-enyl-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl)-N-methyl-3-nitro-N-propylbenzamide |
| SMILES | C=CCCc1nn(-c2ccc(C(=O)N(C)CCC)cc2[N+](=O)[O-])c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C24H30N4O4/c1-6-8-9-17-22-20(14-24(3,4)15-21(22)29)27(25-17)18-11-10-16(13-19(18)28(31)32)23(30)26(5)12-7-2/h6,10-11,13H,1,7-9,12,14-15H2,2-5H3 |
| InChIKey | OLEIEDUOJRJKFE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|