About CID 139213387
CID 139213387 (PubChem CID 139213387) has the molecular formula H3O5Si3
and a molecular weight of 167.28 g/mol.
Molecular Properties
| Compound Name | CID 139213387 |
| PubChem CID | 139213387 |
| Molecular Formula | H3O5Si3 |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 166.93 |
| IUPAC Name | — |
| SMILES | O[Si]O[Si](O)O[Si]O |
| InChI | InChI=1S/H3O5Si3/c1-6-4-8(3)5-7-2/h1-3H |
| InChIKey | OTVFXPOTUTWZOW-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 139213387 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139213387?
The IUPAC name of CID 139213387 (CID 139213387) is not available.
What is the SMILES notation for CID 139213387?
The canonical SMILES for CID 139213387 is O[Si]O[Si](O)O[Si]O.
What is the InChIKey of CID 139213387?
The InChIKey is OTVFXPOTUTWZOW-UHFFFAOYSA-N. The full InChI is InChI=1S/H3O5Si3/c1-6-4-8(3)5-7-2/h1-3H.
What are the key properties of CID 139213387?
CID 139213387 has a molecular weight of 167.28 g/mol, XLogP of -2.95, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139213387 is sourced from PubChem (CID 139213387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).