C35H40N6 — CID 139213436
4-(2,5-dihexylphenyl)-1-[7-(triazol-1-yl)-9H-fluoren-2-yl]triazole (PubChem CID 139213436) has the molecular formula C35H40N6 and a molecular weight of 544.75 g/mol. Its IUPAC name is 4-(2,5-dihexylphenyl)-1-[7-(triazol-1-yl)-9H-fluoren-2-yl]triazole.
| Compound Name | 4-(2,5-dihexylphenyl)-1-[7-(triazol-1-yl)-9H-fluoren-2-yl]triazole |
|---|---|
| PubChem CID | 139213436 |
| Molecular Formula | C35H40N6 |
| Molecular Weight | 544.75 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | 4-(2,5-dihexylphenyl)-1-[7-(triazol-1-yl)-9H-fluoren-2-yl]triazole |
| SMILES | CCCCCCc1ccc(CCCCCC)c(-c2cn(-c3ccc4c(c3)Cc3cc(-n5ccnn5)ccc3-4)nn2)c1 |
| InChI | InChI=1S/C35H40N6/c1-3-5-7-9-11-26-13-14-27(12-10-8-6-4-2)34(21-26)35-25-41(39-37-35)31-16-18-33-29(24-31)22-28-23-30(15-17-32(28)33)40-20-19-36-38-40/h13-21,23-25H,3-12,22H2,1-2H3 |
| InChIKey | RMFAHUWDCKOZRH-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.75 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|