C19H32O5 — CID 139213501
ethylbenzene;2-hydroxyethyl 2-methylpropanoate;methyl 2-methylpropanoate (PubChem CID 139213501) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is ethylbenzene;2-hydroxyethyl 2-methylpropanoate;methyl 2-methylpropanoate.
| Compound Name | ethylbenzene;2-hydroxyethyl 2-methylpropanoate;methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 139213501 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | ethylbenzene;2-hydroxyethyl 2-methylpropanoate;methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCO.CCc1ccccc1.COC(=O)C(C)C |
| InChI | InChI=1S/C8H10.C6H12O3.C5H10O2/c1-2-8-6-4-3-5-7-8;1-5(2)6(8)9-4-3-7;1-4(2)5(6)7-3/h3-7H,2H2,1H3;5,7H,3-4H2,1-2H3;4H,1-3H3 |
| InChIKey | VGQOKQQUQGVVHM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |