About 2-methyl-N-propan-2-ylpropanamide;N,N,2-trimethylpropanamide
2-methyl-N-propan-2-ylpropanamide;N,N,2-trimethylpropanamide (PubChem CID 139213516) has the molecular formula C13H28N2O2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-methyl-N-propan-2-ylpropanamide;N,N,2-trimethylpropanamide.
Molecular Properties
| Compound Name | 2-methyl-N-propan-2-ylpropanamide;N,N,2-trimethylpropanamide |
| PubChem CID | 139213516 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 2-methyl-N-propan-2-ylpropanamide;N,N,2-trimethylpropanamide |
| SMILES | CC(C)C(=O)N(C)C.CC(C)NC(=O)C(C)C |
| InChI | InChI=1S/C7H15NO.C6H13NO/c1-5(2)7(9)8-6(3)4;1-5(2)6(8)7(3)4/h5-6H,1-4H3,(H,8,9);5H,1-4H3 |
| InChIKey | FROQTQIIOUWMDC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-N-propan-2-ylpropanamide;N,N,2-trimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-propan-2-ylpropanamide;N,N,2-trimethylpropanamide?
The IUPAC name of 2-methyl-N-propan-2-ylpropanamide;N,N,2-trimethylpropanamide (CID 139213516) is 2-methyl-N-propan-2-ylpropanamide;N,N,2-trimethylpropanamide.
What is the SMILES notation for 2-methyl-N-propan-2-ylpropanamide;N,N,2-trimethylpropanamide?
The canonical SMILES for 2-methyl-N-propan-2-ylpropanamide;N,N,2-trimethylpropanamide is CC(C)C(=O)N(C)C.CC(C)NC(=O)C(C)C.
What is the InChIKey of 2-methyl-N-propan-2-ylpropanamide;N,N,2-trimethylpropanamide?
The InChIKey is FROQTQIIOUWMDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C6H13NO/c1-5(2)7(9)8-6(3)4;1-5(2)6(8)7(3)4/h5-6H,1-4H3,(H,8,9);5H,1-4H3.
What are the key properties of 2-methyl-N-propan-2-ylpropanamide;N,N,2-trimethylpropanamide?
2-methyl-N-propan-2-ylpropanamide;N,N,2-trimethylpropanamide has a molecular weight of 244.38 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-propan-2-ylpropanamide;N,N,2-trimethylpropanamide is sourced from PubChem (CID 139213516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).