C48H32N4O4Zn — CID 139213555
zinc 4-[10-(4-carboxyphenyl)-15,20-bis(4-methylphenyl)porphyrin-21,23-diid-5-yl]benzoic acid (PubChem CID 139213555) has the molecular formula C48H32N4O4Zn and a molecular weight of 794.20 g/mol. Its IUPAC name is zinc 4-[10-(4-carboxyphenyl)-15,20-bis(4-methylphenyl)porphyrin-21,23-diid-5-yl]benzoic acid.
| Compound Name | zinc 4-[10-(4-carboxyphenyl)-15,20-bis(4-methylphenyl)porphyrin-21,23-diid-5-yl]benzoic acid |
|---|---|
| PubChem CID | 139213555 |
| Molecular Formula | C48H32N4O4Zn |
| Molecular Weight | 794.20 g/mol |
| Exact Mass | 792.17 |
| IUPAC Name | zinc 4-[10-(4-carboxyphenyl)-15,20-bis(4-methylphenyl)porphyrin-21,23-diid-5-yl]benzoic acid |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([n-]4)c(-c4ccc(C(=O)O)cc4)c4nc(c(-c5ccc(C(=O)O)cc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C48H34N4O4.Zn/c1-27-3-7-29(8-4-27)43-35-19-20-36(49-35)44(30-9-5-28(2)6-10-30)38-22-24-40(51-38)46(32-13-17-34(18-14-32)48(55)56)42-26-25-41(52-42)45(39-23-21-37(43)50-39)31-11-15-33(16-12-31)47(53)54;/h3-26H,1-2H3,(H4,49,50,51,52,53,54,55,56);/q;+2/p-2/b43-35-,43-37-,44-36-,44-38-,45-39-,45-41-,46-40-,46-42-; |
| InChIKey | GACNEIUPEPABEQ-ZNCOPPMJSA-L |
| XLogP | 10.59 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.20 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|