C18H16N4S — CID 139213695
3-methyl-1,4-diphenyl-5,7-dihydro-4H-pyrazolo[5,4-d]pyrimidine-6-thione (PubChem CID 139213695) has the molecular formula C18H16N4S and a molecular weight of 320.42 g/mol. Its IUPAC name is 3-methyl-1,4-diphenyl-5,7-dihydro-4H-pyrazolo[5,4-d]pyrimidine-6-thione.
| Compound Name | 3-methyl-1,4-diphenyl-5,7-dihydro-4H-pyrazolo[5,4-d]pyrimidine-6-thione |
|---|---|
| PubChem CID | 139213695 |
| Molecular Formula | C18H16N4S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 3-methyl-1,4-diphenyl-5,7-dihydro-4H-pyrazolo[5,4-d]pyrimidine-6-thione |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1ccccc1)NC(=S)N2 |
| InChI | InChI=1S/C18H16N4S/c1-12-15-16(13-8-4-2-5-9-13)19-18(23)20-17(15)22(21-12)14-10-6-3-7-11-14/h2-11,16H,1H3,(H2,19,20,23) |
| InChIKey | PXDSVWLZDDBJDI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|