C25H26N2O2S — CID 139214173
ethyl (2R,8R)-18-methyl-8-phenyl-5-thia-3,11-diazapentacyclo[9.7.0.02,9.03,7.012,17]octadeca-1(18),12,14,16-tetraene-9-carboxylate (PubChem CID 139214173) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is ethyl (2R,8R)-18-methyl-8-phenyl-5-thia-3,11-diazapentacyclo[9.7.0.02,9.03,7.012,17]octadeca-1(18),12,14,16-tetraene-9-carboxylate.
| Compound Name | ethyl (2R,8R)-18-methyl-8-phenyl-5-thia-3,11-diazapentacyclo[9.7.0.02,9.03,7.012,17]octadeca-1(18),12,14,16-tetraene-9-carboxylate |
|---|---|
| PubChem CID | 139214173 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | ethyl (2R,8R)-18-methyl-8-phenyl-5-thia-3,11-diazapentacyclo[9.7.0.02,9.03,7.012,17]octadeca-1(18),12,14,16-tetraene-9-carboxylate |
| SMILES | CCOC(=O)C12Cn3c(c(C)c4ccccc43)[C@@H]1N1CSCC1[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C25H26N2O2S/c1-3-29-24(28)25-14-26-19-12-8-7-11-18(19)16(2)22(26)23(25)27-15-30-13-20(27)21(25)17-9-5-4-6-10-17/h4-12,20-21,23H,3,13-15H2,1-2H3/t20?,21-,23-,25?/m0/s1 |
| InChIKey | VTLUWKICUZRDMZ-XEGYQXJNSA-N |
| XLogP | 4.73 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|