C16H14N6O3S — CID 139214176
1-[[2-(5-nitroindazol-1-yl)acetyl]amino]-3-phenylthiourea (PubChem CID 139214176) has the molecular formula C16H14N6O3S and a molecular weight of 370.39 g/mol. Its IUPAC name is 1-[[2-(5-nitroindazol-1-yl)acetyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[2-(5-nitroindazol-1-yl)acetyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 139214176 |
| Molecular Formula | C16H14N6O3S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 1-[[2-(5-nitroindazol-1-yl)acetyl]amino]-3-phenylthiourea |
| SMILES | O=C(Cn1ncc2cc([N+](=O)[O-])ccc21)NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C16H14N6O3S/c23-15(19-20-16(26)18-12-4-2-1-3-5-12)10-21-14-7-6-13(22(24)25)8-11(14)9-17-21/h1-9H,10H2,(H,19,23)(H2,18,20,26) |
| InChIKey | KDPUFSQRQDCNQU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|