C16H21Br2NO3 — CID 139214237
1-butyl-3-[3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropanecarbonyl]pyrrolidine-2,4-dione (PubChem CID 139214237) has the molecular formula C16H21Br2NO3 and a molecular weight of 435.16 g/mol. Its IUPAC name is 1-butyl-3-[3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropanecarbonyl]pyrrolidine-2,4-dione.
| Compound Name | 1-butyl-3-[3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropanecarbonyl]pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 139214237 |
| Molecular Formula | C16H21Br2NO3 |
| Molecular Weight | 435.16 g/mol |
| Exact Mass | 432.99 |
| IUPAC Name | 1-butyl-3-[3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropanecarbonyl]pyrrolidine-2,4-dione |
| SMILES | CCCCN1CC(=O)C(C(=O)C2C(C=C(Br)Br)C2(C)C)C1=O |
| InChI | InChI=1S/C16H21Br2NO3/c1-4-5-6-19-8-10(20)12(15(19)22)14(21)13-9(7-11(17)18)16(13,2)3/h7,9,12-13H,4-6,8H2,1-3H3 |
| InChIKey | OIRJZSDRNJXEJS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.16 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|