About 2-(4-bromophenyl)-7,7-dimethyl-4-(4-nitrophenyl)-6,8-dihydroquinolin-5-one
2-(4-bromophenyl)-7,7-dimethyl-4-(4-nitrophenyl)-6,8-dihydroquinolin-5-one (PubChem CID 139214348) has the molecular formula C23H19BrN2O3
and a molecular weight of 451.32 g/mol. Its IUPAC name is 2-(4-bromophenyl)-7,7-dimethyl-4-(4-nitrophenyl)-6,8-dihydroquinolin-5-one.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-7,7-dimethyl-4-(4-nitrophenyl)-6,8-dihydroquinolin-5-one |
| PubChem CID | 139214348 |
| Molecular Formula | C23H19BrN2O3 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 2-(4-bromophenyl)-7,7-dimethyl-4-(4-nitrophenyl)-6,8-dihydroquinolin-5-one |
| SMILES | CC1(C)CC(=O)c2c(-c3ccc([N+](=O)[O-])cc3)cc(-c3ccc(Br)cc3)nc2C1 |
| InChI | InChI=1S/C23H19BrN2O3/c1-23(2)12-20-22(21(27)13-23)18(14-5-9-17(10-6-14)26(28)29)11-19(25-20)15-3-7-16(24)8-4-15/h3-11H,12-13H2,1-2H3 |
| InChIKey | ISLIQDCKJBWFEV-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)-7,7-dimethyl-4-(4-nitrophenyl)-6,8-dihydroquinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-7,7-dimethyl-4-(4-nitrophenyl)-6,8-dihydroquinolin-5-one?
The IUPAC name of 2-(4-bromophenyl)-7,7-dimethyl-4-(4-nitrophenyl)-6,8-dihydroquinolin-5-one (CID 139214348) is 2-(4-bromophenyl)-7,7-dimethyl-4-(4-nitrophenyl)-6,8-dihydroquinolin-5-one.
What is the SMILES notation for 2-(4-bromophenyl)-7,7-dimethyl-4-(4-nitrophenyl)-6,8-dihydroquinolin-5-one?
The canonical SMILES for 2-(4-bromophenyl)-7,7-dimethyl-4-(4-nitrophenyl)-6,8-dihydroquinolin-5-one is CC1(C)CC(=O)c2c(-c3ccc([N+](=O)[O-])cc3)cc(-c3ccc(Br)cc3)nc2C1.
What is the InChIKey of 2-(4-bromophenyl)-7,7-dimethyl-4-(4-nitrophenyl)-6,8-dihydroquinolin-5-one?
The InChIKey is ISLIQDCKJBWFEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19BrN2O3/c1-23(2)12-20-22(21(27)13-23)18(14-5-9-17(10-6-14)26(28)29)11-19(25-20)15-3-7-16(24)8-4-15/h3-11H,12-13H2,1-2H3.
What are the key properties of 2-(4-bromophenyl)-7,7-dimethyl-4-(4-nitrophenyl)-6,8-dihydroquinolin-5-one?
2-(4-bromophenyl)-7,7-dimethyl-4-(4-nitrophenyl)-6,8-dihydroquinolin-5-one has a molecular weight of 451.32 g/mol, XLogP of 6.24, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-7,7-dimethyl-4-(4-nitrophenyl)-6,8-dihydroquinolin-5-one is sourced from PubChem (CID 139214348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).