C30H24BrCl2NO — CID 139214414
(6Z)-6-[(4-bromophenyl)methylidene]-2,4-bis(4-chlorophenyl)-7,7-dimethyl-4,8-dihydro-1H-quinolin-5-one (PubChem CID 139214414) has the molecular formula C30H24BrCl2NO and a molecular weight of 565.34 g/mol. Its IUPAC name is (6Z)-6-[(4-bromophenyl)methylidene]-2,4-bis(4-chlorophenyl)-7,7-dimethyl-4,8-dihydro-1H-quinolin-5-one.
| Compound Name | (6Z)-6-[(4-bromophenyl)methylidene]-2,4-bis(4-chlorophenyl)-7,7-dimethyl-4,8-dihydro-1H-quinolin-5-one |
|---|---|
| PubChem CID | 139214414 |
| Molecular Formula | C30H24BrCl2NO |
| Molecular Weight | 565.34 g/mol |
| Exact Mass | 563.04 |
| IUPAC Name | (6Z)-6-[(4-bromophenyl)methylidene]-2,4-bis(4-chlorophenyl)-7,7-dimethyl-4,8-dihydro-1H-quinolin-5-one |
| SMILES | CC1(C)CC2=C(C(=O)/C1=C\c1ccc(Br)cc1)C(c1ccc(Cl)cc1)C=C(c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C30H24BrCl2NO/c1-30(2)17-27-28(29(35)25(30)15-18-3-9-21(31)10-4-18)24(19-5-11-22(32)12-6-19)16-26(34-27)20-7-13-23(33)14-8-20/h3-16,24,34H,17H2,1-2H3/b25-15+ |
| InChIKey | FVXGDNLQARPRSM-MFKUBSTISA-N |
| XLogP | 8.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.34 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|