C32H32N2O — CID 139214449
(6Z)-6-[[4-(dimethylamino)phenyl]methylidene]-7,7-dimethyl-2,4-diphenyl-4,8-dihydro-1H-quinolin-5-one (PubChem CID 139214449) has the molecular formula C32H32N2O and a molecular weight of 460.62 g/mol. Its IUPAC name is (6Z)-6-[[4-(dimethylamino)phenyl]methylidene]-7,7-dimethyl-2,4-diphenyl-4,8-dihydro-1H-quinolin-5-one.
| Compound Name | (6Z)-6-[[4-(dimethylamino)phenyl]methylidene]-7,7-dimethyl-2,4-diphenyl-4,8-dihydro-1H-quinolin-5-one |
|---|---|
| PubChem CID | 139214449 |
| Molecular Formula | C32H32N2O |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | (6Z)-6-[[4-(dimethylamino)phenyl]methylidene]-7,7-dimethyl-2,4-diphenyl-4,8-dihydro-1H-quinolin-5-one |
| SMILES | CN(C)c1ccc(/C=C2\C(=O)C3=C(CC2(C)C)NC(c2ccccc2)=CC3c2ccccc2)cc1 |
| InChI | InChI=1S/C32H32N2O/c1-32(2)21-29-30(31(35)27(32)19-22-15-17-25(18-16-22)34(3)4)26(23-11-7-5-8-12-23)20-28(33-29)24-13-9-6-10-14-24/h5-20,26,33H,21H2,1-4H3/b27-19+ |
| InChIKey | PZCYEYVONJKQIA-ZXVVBBHZSA-N |
| XLogP | 6.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|