C12H14N4O2S — CID 139214514
4,4-dimethyl-5-oxa-8-thia-10,12,13,15-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),13-trien-16-one (PubChem CID 139214514) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 4,4-dimethyl-5-oxa-8-thia-10,12,13,15-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),13-trien-16-one.
| Compound Name | 4,4-dimethyl-5-oxa-8-thia-10,12,13,15-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),13-trien-16-one |
|---|---|
| PubChem CID | 139214514 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4,4-dimethyl-5-oxa-8-thia-10,12,13,15-tetrazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),13-trien-16-one |
| SMILES | CC1(C)Cc2c(sc3c2C(=O)N2C=NNC2N3)CO1 |
| InChI | InChI=1S/C12H14N4O2S/c1-12(2)3-6-7(4-18-12)19-9-8(6)10(17)16-5-13-15-11(16)14-9/h5,11,14-15H,3-4H2,1-2H3 |
| InChIKey | MTHDCMCZLJTTDZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |