About disodium;3,5-dinitropyrazol-1-id-4-olate
disodium;3,5-dinitropyrazol-1-id-4-olate (PubChem CID 139214846) has the molecular formula C3N4Na2O5
and a molecular weight of 218.04 g/mol. Its IUPAC name is disodium;3,5-dinitropyrazol-1-id-4-olate.
Molecular Properties
| Compound Name | disodium;3,5-dinitropyrazol-1-id-4-olate |
| PubChem CID | 139214846 |
| Molecular Formula | C3N4Na2O5 |
| Molecular Weight | 218.04 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | disodium;3,5-dinitropyrazol-1-id-4-olate |
| SMILES | O=[N+]([O-])c1n[n-]c([N+](=O)[O-])c1[O-].[Na+].[Na+] |
| InChI | InChI=1S/C3HN4O5.2Na/c8-1-2(6(9)10)4-5-3(1)7(11)12;;/h(H-,4,5,8);;/q-1;2*+1/p-1 |
| InChIKey | ZMEJKKIKCZUYNF-UHFFFAOYSA-M |
| XLogP | -7.06 |
| TPSA | 136.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.04 |
| LogP ≤ 5 | -7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze disodium;3,5-dinitropyrazol-1-id-4-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;3,5-dinitropyrazol-1-id-4-olate?
The IUPAC name of disodium;3,5-dinitropyrazol-1-id-4-olate (CID 139214846) is disodium;3,5-dinitropyrazol-1-id-4-olate.
What is the SMILES notation for disodium;3,5-dinitropyrazol-1-id-4-olate?
The canonical SMILES for disodium;3,5-dinitropyrazol-1-id-4-olate is O=[N+]([O-])c1n[n-]c([N+](=O)[O-])c1[O-].[Na+].[Na+].
What is the InChIKey of disodium;3,5-dinitropyrazol-1-id-4-olate?
The InChIKey is ZMEJKKIKCZUYNF-UHFFFAOYSA-M. The full InChI is InChI=1S/C3HN4O5.2Na/c8-1-2(6(9)10)4-5-3(1)7(11)12;;/h(H-,4,5,8);;/q-1;2*+1/p-1.
What are the key properties of disodium;3,5-dinitropyrazol-1-id-4-olate?
disodium;3,5-dinitropyrazol-1-id-4-olate has a molecular weight of 218.04 g/mol, XLogP of -7.06, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;3,5-dinitropyrazol-1-id-4-olate is sourced from PubChem (CID 139214846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).