About 1-methyl-3,4-dinitro-N-(1-propylpyrazol-3-yl)pyrazol-5-amine
1-methyl-3,4-dinitro-N-(1-propylpyrazol-3-yl)pyrazol-5-amine (PubChem CID 139214861) has the molecular formula C10H13N7O4
and a molecular weight of 295.26 g/mol. Its IUPAC name is 1-methyl-3,4-dinitro-N-(1-propylpyrazol-3-yl)pyrazol-5-amine.
Molecular Properties
| Compound Name | 1-methyl-3,4-dinitro-N-(1-propylpyrazol-3-yl)pyrazol-5-amine |
| PubChem CID | 139214861 |
| Molecular Formula | C10H13N7O4 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-methyl-3,4-dinitro-N-(1-propylpyrazol-3-yl)pyrazol-5-amine |
| SMILES | CCCn1ccc(Nc2c([N+](=O)[O-])c([N+](=O)[O-])nn2C)n1 |
| InChI | InChI=1S/C10H13N7O4/c1-3-5-15-6-4-7(12-15)11-9-8(16(18)19)10(17(20)21)13-14(9)2/h4,6H,3,5H2,1-2H3,(H,11,12) |
| InChIKey | GNOQCQYMEXDZFP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 133.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3,4-dinitro-N-(1-propylpyrazol-3-yl)pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3,4-dinitro-N-(1-propylpyrazol-3-yl)pyrazol-5-amine?
The IUPAC name of 1-methyl-3,4-dinitro-N-(1-propylpyrazol-3-yl)pyrazol-5-amine (CID 139214861) is 1-methyl-3,4-dinitro-N-(1-propylpyrazol-3-yl)pyrazol-5-amine.
What is the SMILES notation for 1-methyl-3,4-dinitro-N-(1-propylpyrazol-3-yl)pyrazol-5-amine?
The canonical SMILES for 1-methyl-3,4-dinitro-N-(1-propylpyrazol-3-yl)pyrazol-5-amine is CCCn1ccc(Nc2c([N+](=O)[O-])c([N+](=O)[O-])nn2C)n1.
What is the InChIKey of 1-methyl-3,4-dinitro-N-(1-propylpyrazol-3-yl)pyrazol-5-amine?
The InChIKey is GNOQCQYMEXDZFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N7O4/c1-3-5-15-6-4-7(12-15)11-9-8(16(18)19)10(17(20)21)13-14(9)2/h4,6H,3,5H2,1-2H3,(H,11,12).
What are the key properties of 1-methyl-3,4-dinitro-N-(1-propylpyrazol-3-yl)pyrazol-5-amine?
1-methyl-3,4-dinitro-N-(1-propylpyrazol-3-yl)pyrazol-5-amine has a molecular weight of 295.26 g/mol, XLogP of 1.59, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,4-dinitro-N-(1-propylpyrazol-3-yl)pyrazol-5-amine is sourced from PubChem (CID 139214861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).