C20H21NO5 — CID 139214877
benzyl 2-benzyl-3,4-dihydroxy-4-methyl-5-oxopyrrolidine-2-carboxylate (PubChem CID 139214877) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is benzyl 2-benzyl-3,4-dihydroxy-4-methyl-5-oxopyrrolidine-2-carboxylate.
| Compound Name | benzyl 2-benzyl-3,4-dihydroxy-4-methyl-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 139214877 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | benzyl 2-benzyl-3,4-dihydroxy-4-methyl-5-oxopyrrolidine-2-carboxylate |
| SMILES | CC1(O)C(=O)NC(Cc2ccccc2)(C(=O)OCc2ccccc2)C1O |
| InChI | InChI=1S/C20H21NO5/c1-19(25)16(22)20(21-17(19)23,12-14-8-4-2-5-9-14)18(24)26-13-15-10-6-3-7-11-15/h2-11,16,22,25H,12-13H2,1H3,(H,21,23) |
| InChIKey | XQELIFUBLPPCNK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |