C19H14BrN3O — CID 139214966
16-(4-bromophenyl)-4,5,10-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),3,7,11(15)-pentaen-14-one (PubChem CID 139214966) has the molecular formula C19H14BrN3O and a molecular weight of 380.25 g/mol. Its IUPAC name is 16-(4-bromophenyl)-4,5,10-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),3,7,11(15)-pentaen-14-one.
| Compound Name | 16-(4-bromophenyl)-4,5,10-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),3,7,11(15)-pentaen-14-one |
|---|---|
| PubChem CID | 139214966 |
| Molecular Formula | C19H14BrN3O |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 16-(4-bromophenyl)-4,5,10-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),3,7,11(15)-pentaen-14-one |
| SMILES | O=C1CCC2=C1C(c1ccc(Br)cc1)c1c(ccc3[nH]ncc13)N2 |
| InChI | InChI=1S/C19H14BrN3O/c20-11-3-1-10(2-4-11)17-18-12-9-21-23-13(12)5-6-14(18)22-15-7-8-16(24)19(15)17/h1-6,9,17,22H,7-8H2,(H,21,23) |
| InChIKey | JUYXDFJOPOQBHW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |