C21H17N3O3 — CID 139214970
16-(1,3-benzodioxol-5-ylmethyl)-4,5,10-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),3,7,11(15)-pentaen-14-one (PubChem CID 139214970) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is 16-(1,3-benzodioxol-5-ylmethyl)-4,5,10-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),3,7,11(15)-pentaen-14-one.
| Compound Name | 16-(1,3-benzodioxol-5-ylmethyl)-4,5,10-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),3,7,11(15)-pentaen-14-one |
|---|---|
| PubChem CID | 139214970 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 16-(1,3-benzodioxol-5-ylmethyl)-4,5,10-triazatetracyclo[7.7.0.02,6.011,15]hexadeca-1(9),2(6),3,7,11(15)-pentaen-14-one |
| SMILES | O=C1CCC2=C1C(Cc1ccc3c(c1)OCO3)c1c(ccc3[nH]ncc13)N2 |
| InChI | InChI=1S/C21H17N3O3/c25-17-5-4-16-21(17)12(7-11-1-6-18-19(8-11)27-10-26-18)20-13-9-22-24-14(13)2-3-15(20)23-16/h1-3,6,8-9,12,23H,4-5,7,10H2,(H,22,24) |
| InChIKey | TUNRJGIETIZEKQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |