About 2,4-dihexylpyrimidine
2,4-dihexylpyrimidine (PubChem CID 139215002) has the molecular formula C16H28N2
and a molecular weight of 248.41 g/mol. Its IUPAC name is 2,4-dihexylpyrimidine.
Molecular Properties
| Compound Name | 2,4-dihexylpyrimidine |
| PubChem CID | 139215002 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 2,4-dihexylpyrimidine |
| SMILES | CCCCCCc1ccnc(CCCCCC)n1 |
| InChI | InChI=1S/C16H28N2/c1-3-5-7-9-11-15-13-14-17-16(18-15)12-10-8-6-4-2/h13-14H,3-12H2,1-2H3 |
| InChIKey | QPEDMIZXNIRILB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dihexylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihexylpyrimidine?
The IUPAC name of 2,4-dihexylpyrimidine (CID 139215002) is 2,4-dihexylpyrimidine.
What is the SMILES notation for 2,4-dihexylpyrimidine?
The canonical SMILES for 2,4-dihexylpyrimidine is CCCCCCc1ccnc(CCCCCC)n1.
What is the InChIKey of 2,4-dihexylpyrimidine?
The InChIKey is QPEDMIZXNIRILB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2/c1-3-5-7-9-11-15-13-14-17-16(18-15)12-10-8-6-4-2/h13-14H,3-12H2,1-2H3.
What are the key properties of 2,4-dihexylpyrimidine?
2,4-dihexylpyrimidine has a molecular weight of 248.41 g/mol, XLogP of 4.72, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihexylpyrimidine is sourced from PubChem (CID 139215002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).