About 12-(2-chlorophenyl)-2,9-dimethyl-6H-quinolino[2,3-b]quinolin-11-one
12-(2-chlorophenyl)-2,9-dimethyl-6H-quinolino[2,3-b]quinolin-11-one (PubChem CID 139215720) has the molecular formula C24H17ClN2O
and a molecular weight of 384.87 g/mol. Its IUPAC name is 12-(2-chlorophenyl)-2,9-dimethyl-6H-quinolino[2,3-b]quinolin-11-one.
Molecular Properties
| Compound Name | 12-(2-chlorophenyl)-2,9-dimethyl-6H-quinolino[2,3-b]quinolin-11-one |
| PubChem CID | 139215720 |
| Molecular Formula | C24H17ClN2O |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 12-(2-chlorophenyl)-2,9-dimethyl-6H-quinolino[2,3-b]quinolin-11-one |
| SMILES | Cc1ccc2nc3[nH]c4ccc(C)cc4c(=O)c3c(-c3ccccc3Cl)c2c1 |
| InChI | InChI=1S/C24H17ClN2O/c1-13-7-9-19-16(11-13)21(15-5-3-4-6-18(15)25)22-23(28)17-12-14(2)8-10-20(17)27-24(22)26-19/h3-12H,1-2H3,(H,26,27,28) |
| InChIKey | MDNZUNBCUJWZAS-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 12-(2-chlorophenyl)-2,9-dimethyl-6H-quinolino[2,3-b]quinolin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-(2-chlorophenyl)-2,9-dimethyl-6H-quinolino[2,3-b]quinolin-11-one?
The IUPAC name of 12-(2-chlorophenyl)-2,9-dimethyl-6H-quinolino[2,3-b]quinolin-11-one (CID 139215720) is 12-(2-chlorophenyl)-2,9-dimethyl-6H-quinolino[2,3-b]quinolin-11-one.
What is the SMILES notation for 12-(2-chlorophenyl)-2,9-dimethyl-6H-quinolino[2,3-b]quinolin-11-one?
The canonical SMILES for 12-(2-chlorophenyl)-2,9-dimethyl-6H-quinolino[2,3-b]quinolin-11-one is Cc1ccc2nc3[nH]c4ccc(C)cc4c(=O)c3c(-c3ccccc3Cl)c2c1.
What is the InChIKey of 12-(2-chlorophenyl)-2,9-dimethyl-6H-quinolino[2,3-b]quinolin-11-one?
The InChIKey is MDNZUNBCUJWZAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17ClN2O/c1-13-7-9-19-16(11-13)21(15-5-3-4-6-18(15)25)22-23(28)17-12-14(2)8-10-20(17)27-24(22)26-19/h3-12H,1-2H3,(H,26,27,28).
What are the key properties of 12-(2-chlorophenyl)-2,9-dimethyl-6H-quinolino[2,3-b]quinolin-11-one?
12-(2-chlorophenyl)-2,9-dimethyl-6H-quinolino[2,3-b]quinolin-11-one has a molecular weight of 384.87 g/mol, XLogP of 6.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-(2-chlorophenyl)-2,9-dimethyl-6H-quinolino[2,3-b]quinolin-11-one is sourced from PubChem (CID 139215720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).