C22H23N3O5S2 — CID 139215844
diethyl (5S,6R)-6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenyl-4-sulfanylidene-5H-1,3-oxazine-5,6-dicarboxylate (PubChem CID 139215844) has the molecular formula C22H23N3O5S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is diethyl (5S,6R)-6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenyl-4-sulfanylidene-5H-1,3-oxazine-5,6-dicarboxylate.
| Compound Name | diethyl (5S,6R)-6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenyl-4-sulfanylidene-5H-1,3-oxazine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 139215844 |
| Molecular Formula | C22H23N3O5S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | diethyl (5S,6R)-6-(4,6-dimethylpyrimidin-2-yl)sulfanyl-2-phenyl-4-sulfanylidene-5H-1,3-oxazine-5,6-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=S)N=C(c2ccccc2)O[C@]1(Sc1nc(C)cc(C)n1)C(=O)OCC |
| InChI | InChI=1S/C22H23N3O5S2/c1-5-28-19(26)16-18(31)25-17(15-10-8-7-9-11-15)30-22(16,20(27)29-6-2)32-21-23-13(3)12-14(4)24-21/h7-12,16H,5-6H2,1-4H3/t16-,22+/m0/s1 |
| InChIKey | JNFVHJQKXFHAMA-KSFYIVLOSA-N |
| XLogP | 3.43 |
| TPSA | 99.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|