C18H15F2N3O2 — CID 139216505
2-(3,4-difluorophenyl)-N-[2-(1-methylindazol-3-yl)-2-oxoethyl]acetamide (PubChem CID 139216505) has the molecular formula C18H15F2N3O2 and a molecular weight of 343.33 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-N-[2-(1-methylindazol-3-yl)-2-oxoethyl]acetamide.
| Compound Name | 2-(3,4-difluorophenyl)-N-[2-(1-methylindazol-3-yl)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 139216505 |
| Molecular Formula | C18H15F2N3O2 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-(3,4-difluorophenyl)-N-[2-(1-methylindazol-3-yl)-2-oxoethyl]acetamide |
| SMILES | Cn1nc(C(=O)CNC(=O)Cc2ccc(F)c(F)c2)c2ccccc21 |
| InChI | InChI=1S/C18H15F2N3O2/c1-23-15-5-3-2-4-12(15)18(22-23)16(24)10-21-17(25)9-11-6-7-13(19)14(20)8-11/h2-8H,9-10H2,1H3,(H,21,25) |
| InChIKey | LTKINRDAMZRXPZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |