About 2-[(3,4-difluorophenyl)methyl]-5-(1-methylindazol-3-yl)-1,3-oxazole
2-[(3,4-difluorophenyl)methyl]-5-(1-methylindazol-3-yl)-1,3-oxazole (PubChem CID 139216515) has the molecular formula C18H13F2N3O
and a molecular weight of 325.32 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)methyl]-5-(1-methylindazol-3-yl)-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[(3,4-difluorophenyl)methyl]-5-(1-methylindazol-3-yl)-1,3-oxazole |
| PubChem CID | 139216515 |
| Molecular Formula | C18H13F2N3O |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2-[(3,4-difluorophenyl)methyl]-5-(1-methylindazol-3-yl)-1,3-oxazole |
| SMILES | Cn1nc(-c2cnc(Cc3ccc(F)c(F)c3)o2)c2ccccc21 |
| InChI | InChI=1S/C18H13F2N3O/c1-23-15-5-3-2-4-12(15)18(22-23)16-10-21-17(24-16)9-11-6-7-13(19)14(20)8-11/h2-8,10H,9H2,1H3 |
| InChIKey | JKMDCIUMHBCWFY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3,4-difluorophenyl)methyl]-5-(1-methylindazol-3-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4-difluorophenyl)methyl]-5-(1-methylindazol-3-yl)-1,3-oxazole?
The IUPAC name of 2-[(3,4-difluorophenyl)methyl]-5-(1-methylindazol-3-yl)-1,3-oxazole (CID 139216515) is 2-[(3,4-difluorophenyl)methyl]-5-(1-methylindazol-3-yl)-1,3-oxazole.
What is the SMILES notation for 2-[(3,4-difluorophenyl)methyl]-5-(1-methylindazol-3-yl)-1,3-oxazole?
The canonical SMILES for 2-[(3,4-difluorophenyl)methyl]-5-(1-methylindazol-3-yl)-1,3-oxazole is Cn1nc(-c2cnc(Cc3ccc(F)c(F)c3)o2)c2ccccc21.
What is the InChIKey of 2-[(3,4-difluorophenyl)methyl]-5-(1-methylindazol-3-yl)-1,3-oxazole?
The InChIKey is JKMDCIUMHBCWFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F2N3O/c1-23-15-5-3-2-4-12(15)18(22-23)16-10-21-17(24-16)9-11-6-7-13(19)14(20)8-11/h2-8,10H,9H2,1H3.
What are the key properties of 2-[(3,4-difluorophenyl)methyl]-5-(1-methylindazol-3-yl)-1,3-oxazole?
2-[(3,4-difluorophenyl)methyl]-5-(1-methylindazol-3-yl)-1,3-oxazole has a molecular weight of 325.32 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-difluorophenyl)methyl]-5-(1-methylindazol-3-yl)-1,3-oxazole is sourced from PubChem (CID 139216515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).