About [(E)-1-(1,3-dioxoinden-2-yl)propylideneamino]thiourea
[(E)-1-(1,3-dioxoinden-2-yl)propylideneamino]thiourea (PubChem CID 139216777) has the molecular formula C13H13N3O2S
and a molecular weight of 275.33 g/mol. Its IUPAC name is [(E)-1-(1,3-dioxoinden-2-yl)propylideneamino]thiourea.
Molecular Properties
| Compound Name | [(E)-1-(1,3-dioxoinden-2-yl)propylideneamino]thiourea |
| PubChem CID | 139216777 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | [(E)-1-(1,3-dioxoinden-2-yl)propylideneamino]thiourea |
| SMILES | CC/C(=N\NC(N)=S)C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H13N3O2S/c1-2-9(15-16-13(14)19)10-11(17)7-5-3-4-6-8(7)12(10)18/h3-6,10H,2H2,1H3,(H3,14,16,19)/b15-9+ |
| InChIKey | IKUTXSPTOZKFDW-OQLLNIDSSA-N |
| XLogP | 1.28 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-(1,3-dioxoinden-2-yl)propylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-(1,3-dioxoinden-2-yl)propylideneamino]thiourea?
The IUPAC name of [(E)-1-(1,3-dioxoinden-2-yl)propylideneamino]thiourea (CID 139216777) is [(E)-1-(1,3-dioxoinden-2-yl)propylideneamino]thiourea.
What is the SMILES notation for [(E)-1-(1,3-dioxoinden-2-yl)propylideneamino]thiourea?
The canonical SMILES for [(E)-1-(1,3-dioxoinden-2-yl)propylideneamino]thiourea is CC/C(=N\NC(N)=S)C1C(=O)c2ccccc2C1=O.
What is the InChIKey of [(E)-1-(1,3-dioxoinden-2-yl)propylideneamino]thiourea?
The InChIKey is IKUTXSPTOZKFDW-OQLLNIDSSA-N. The full InChI is InChI=1S/C13H13N3O2S/c1-2-9(15-16-13(14)19)10-11(17)7-5-3-4-6-8(7)12(10)18/h3-6,10H,2H2,1H3,(H3,14,16,19)/b15-9+.
What are the key properties of [(E)-1-(1,3-dioxoinden-2-yl)propylideneamino]thiourea?
[(E)-1-(1,3-dioxoinden-2-yl)propylideneamino]thiourea has a molecular weight of 275.33 g/mol, XLogP of 1.28, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-(1,3-dioxoinden-2-yl)propylideneamino]thiourea is sourced from PubChem (CID 139216777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).