C20H26N2O4 — CID 139216840
diethyl 2-[(2,2,4-trimethyl-3H-1,5-benzodiazepin-1-yl)methylidene]propanedioate (PubChem CID 139216840) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is diethyl 2-[(2,2,4-trimethyl-3H-1,5-benzodiazepin-1-yl)methylidene]propanedioate.
| Compound Name | diethyl 2-[(2,2,4-trimethyl-3H-1,5-benzodiazepin-1-yl)methylidene]propanedioate |
|---|---|
| PubChem CID | 139216840 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | diethyl 2-[(2,2,4-trimethyl-3H-1,5-benzodiazepin-1-yl)methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CN1c2ccccc2N=C(C)CC1(C)C)C(=O)OCC |
| InChI | InChI=1S/C20H26N2O4/c1-6-25-18(23)15(19(24)26-7-2)13-22-17-11-9-8-10-16(17)21-14(3)12-20(22,4)5/h8-11,13H,6-7,12H2,1-5H3 |
| InChIKey | QJJYQBAGPLEMJM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|