C19H17N5O6 — CID 139216946
9-(3,4-dimethoxyphenyl)-4,14-dimethyl-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1,3(8),9-triene-5,7,11,13-tetrone (PubChem CID 139216946) has the molecular formula C19H17N5O6 and a molecular weight of 411.37 g/mol. Its IUPAC name is 9-(3,4-dimethoxyphenyl)-4,14-dimethyl-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1,3(8),9-triene-5,7,11,13-tetrone.
| Compound Name | 9-(3,4-dimethoxyphenyl)-4,14-dimethyl-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1,3(8),9-triene-5,7,11,13-tetrone |
|---|---|
| PubChem CID | 139216946 |
| Molecular Formula | C19H17N5O6 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 9-(3,4-dimethoxyphenyl)-4,14-dimethyl-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1,3(8),9-triene-5,7,11,13-tetrone |
| SMILES | COc1ccc(-c2c3c(=O)[nH]c(=O)n(C)c3nc3c2c(=O)[nH]c(=O)n3C)cc1OC |
| InChI | InChI=1S/C19H17N5O6/c1-23-14-12(16(25)21-18(23)27)11(8-5-6-9(29-3)10(7-8)30-4)13-15(20-14)24(2)19(28)22-17(13)26/h5-7H,1-4H3,(H,21,25,27)(H,22,26,28) |
| InChIKey | ZCLXYYGOXWDKJH-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 141.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|