About (4-bromophenyl)-[2-[(E)-2-(dimethylamino)ethenyl]-1,3-thiazol-5-yl]methanone
(4-bromophenyl)-[2-[(E)-2-(dimethylamino)ethenyl]-1,3-thiazol-5-yl]methanone (PubChem CID 139217328) has the molecular formula C14H13BrN2OS
and a molecular weight of 337.24 g/mol. Its IUPAC name is (4-bromophenyl)-[2-[(E)-2-(dimethylamino)ethenyl]-1,3-thiazol-5-yl]methanone.
Molecular Properties
| Compound Name | (4-bromophenyl)-[2-[(E)-2-(dimethylamino)ethenyl]-1,3-thiazol-5-yl]methanone |
| PubChem CID | 139217328 |
| Molecular Formula | C14H13BrN2OS |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | (4-bromophenyl)-[2-[(E)-2-(dimethylamino)ethenyl]-1,3-thiazol-5-yl]methanone |
| SMILES | CN(C)/C=C/c1ncc(C(=O)c2ccc(Br)cc2)s1 |
| InChI | InChI=1S/C14H13BrN2OS/c1-17(2)8-7-13-16-9-12(19-13)14(18)10-3-5-11(15)6-4-10/h3-9H,1-2H3/b8-7+ |
| InChIKey | YLKRRDHGAQOPBC-BQYQJAHWSA-N |
| XLogP | 3.67 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-bromophenyl)-[2-[(E)-2-(dimethylamino)ethenyl]-1,3-thiazol-5-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)-[2-[(E)-2-(dimethylamino)ethenyl]-1,3-thiazol-5-yl]methanone?
The IUPAC name of (4-bromophenyl)-[2-[(E)-2-(dimethylamino)ethenyl]-1,3-thiazol-5-yl]methanone (CID 139217328) is (4-bromophenyl)-[2-[(E)-2-(dimethylamino)ethenyl]-1,3-thiazol-5-yl]methanone.
What is the SMILES notation for (4-bromophenyl)-[2-[(E)-2-(dimethylamino)ethenyl]-1,3-thiazol-5-yl]methanone?
The canonical SMILES for (4-bromophenyl)-[2-[(E)-2-(dimethylamino)ethenyl]-1,3-thiazol-5-yl]methanone is CN(C)/C=C/c1ncc(C(=O)c2ccc(Br)cc2)s1.
What is the InChIKey of (4-bromophenyl)-[2-[(E)-2-(dimethylamino)ethenyl]-1,3-thiazol-5-yl]methanone?
The InChIKey is YLKRRDHGAQOPBC-BQYQJAHWSA-N. The full InChI is InChI=1S/C14H13BrN2OS/c1-17(2)8-7-13-16-9-12(19-13)14(18)10-3-5-11(15)6-4-10/h3-9H,1-2H3/b8-7+.
What are the key properties of (4-bromophenyl)-[2-[(E)-2-(dimethylamino)ethenyl]-1,3-thiazol-5-yl]methanone?
(4-bromophenyl)-[2-[(E)-2-(dimethylamino)ethenyl]-1,3-thiazol-5-yl]methanone has a molecular weight of 337.24 g/mol, XLogP of 3.67, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)-[2-[(E)-2-(dimethylamino)ethenyl]-1,3-thiazol-5-yl]methanone is sourced from PubChem (CID 139217328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).