C10H9Li2NO3 — CID 139217731
dilithium;6-methoxy-2-methyl-3-oxo-1,4-dihydroisoindol-4-id-1-olate (PubChem CID 139217731) has the molecular formula C10H9Li2NO3 and a molecular weight of 205.07 g/mol. Its IUPAC name is dilithium;6-methoxy-2-methyl-3-oxo-1,4-dihydroisoindol-4-id-1-olate.
| Compound Name | dilithium;6-methoxy-2-methyl-3-oxo-1,4-dihydroisoindol-4-id-1-olate |
|---|---|
| PubChem CID | 139217731 |
| Molecular Formula | C10H9Li2NO3 |
| Molecular Weight | 205.07 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | dilithium;6-methoxy-2-methyl-3-oxo-1,4-dihydroisoindol-4-id-1-olate |
| SMILES | COc1c[c-]c2c(c1)C([O-])N(C)C2=O.[Li+].[Li+] |
| InChI | InChI=1S/C10H9NO3.2Li/c1-11-9(12)7-4-3-6(14-2)5-8(7)10(11)13;;/h3,5,10H,1-2H3;;/q-2;2*+1 |
| InChIKey | QRQQVRUBUPJEMO-UHFFFAOYSA-N |
| XLogP | -6.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.07 |
| LogP ≤ 5 | -6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|