About ethyl 5-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]-5-(phenoxymethyl)-4H-1,2-oxazole-3-carboxylate
ethyl 5-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]-5-(phenoxymethyl)-4H-1,2-oxazole-3-carboxylate (PubChem CID 139217887) has the molecular formula C19H24N3O5+
and a molecular weight of 374.42 g/mol. Its IUPAC name is ethyl 5-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]-5-(phenoxymethyl)-4H-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]-5-(phenoxymethyl)-4H-1,2-oxazole-3-carboxylate |
| PubChem CID | 139217887 |
| Molecular Formula | C19H24N3O5+ |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | ethyl 5-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]-5-(phenoxymethyl)-4H-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NOC(COc2ccccc2)(OCCn2cc[n+](C)c2)C1 |
| InChI | InChI=1S/C19H24N3O5/c1-3-24-18(23)17-13-19(27-20-17,14-25-16-7-5-4-6-8-16)26-12-11-22-10-9-21(2)15-22/h4-10,15H,3,11-14H2,1-2H3/q+1 |
| InChIKey | NXAPDWJBMWXIOO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]-5-(phenoxymethyl)-4H-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]-5-(phenoxymethyl)-4H-1,2-oxazole-3-carboxylate?
The IUPAC name of ethyl 5-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]-5-(phenoxymethyl)-4H-1,2-oxazole-3-carboxylate (CID 139217887) is ethyl 5-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]-5-(phenoxymethyl)-4H-1,2-oxazole-3-carboxylate.
What is the SMILES notation for ethyl 5-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]-5-(phenoxymethyl)-4H-1,2-oxazole-3-carboxylate?
The canonical SMILES for ethyl 5-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]-5-(phenoxymethyl)-4H-1,2-oxazole-3-carboxylate is CCOC(=O)C1=NOC(COc2ccccc2)(OCCn2cc[n+](C)c2)C1.
What is the InChIKey of ethyl 5-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]-5-(phenoxymethyl)-4H-1,2-oxazole-3-carboxylate?
The InChIKey is NXAPDWJBMWXIOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N3O5/c1-3-24-18(23)17-13-19(27-20-17,14-25-16-7-5-4-6-8-16)26-12-11-22-10-9-21(2)15-22/h4-10,15H,3,11-14H2,1-2H3/q+1.
What are the key properties of ethyl 5-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]-5-(phenoxymethyl)-4H-1,2-oxazole-3-carboxylate?
ethyl 5-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]-5-(phenoxymethyl)-4H-1,2-oxazole-3-carboxylate has a molecular weight of 374.42 g/mol, XLogP of 1.44, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[2-(3-methylimidazol-3-ium-1-yl)ethoxy]-5-(phenoxymethyl)-4H-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 139217887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).