C29H41NO4S — CID 139218030
(E)-3-cyclohexyl-1-[(3R,4R)-4-[(E)-2-cyclohexylethenyl]-4-hydroxy-1-(4-methylphenyl)sulfonylpiperidin-3-yl]prop-2-en-1-one (PubChem CID 139218030) has the molecular formula C29H41NO4S and a molecular weight of 499.72 g/mol. Its IUPAC name is (E)-3-cyclohexyl-1-[(3R,4R)-4-[(E)-2-cyclohexylethenyl]-4-hydroxy-1-(4-methylphenyl)sulfonylpiperidin-3-yl]prop-2-en-1-one.
| Compound Name | (E)-3-cyclohexyl-1-[(3R,4R)-4-[(E)-2-cyclohexylethenyl]-4-hydroxy-1-(4-methylphenyl)sulfonylpiperidin-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139218030 |
| Molecular Formula | C29H41NO4S |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | (E)-3-cyclohexyl-1-[(3R,4R)-4-[(E)-2-cyclohexylethenyl]-4-hydroxy-1-(4-methylphenyl)sulfonylpiperidin-3-yl]prop-2-en-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@](O)(/C=C/C3CCCCC3)[C@H](C(=O)/C=C/C3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C29H41NO4S/c1-23-12-15-26(16-13-23)35(33,34)30-21-20-29(32,19-18-25-10-6-3-7-11-25)27(22-30)28(31)17-14-24-8-4-2-5-9-24/h12-19,24-25,27,32H,2-11,20-22H2,1H3/b17-14+,19-18+/t27-,29-/m0/s1 |
| InChIKey | LUEXOTFOFUCATF-LEWBCEPMSA-N |
| XLogP | 5.58 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|