C29H29NO4S — CID 139218034
(4aR,8aR)-6-(4-methylphenyl)sulfonyl-2-phenyl-8a-[(E)-2-phenylethenyl]-2,3,4a,5,7,8-hexahydropyrano[3,2-c]pyridin-4-one (PubChem CID 139218034) has the molecular formula C29H29NO4S and a molecular weight of 487.62 g/mol. Its IUPAC name is (4aR,8aR)-6-(4-methylphenyl)sulfonyl-2-phenyl-8a-[(E)-2-phenylethenyl]-2,3,4a,5,7,8-hexahydropyrano[3,2-c]pyridin-4-one.
| Compound Name | (4aR,8aR)-6-(4-methylphenyl)sulfonyl-2-phenyl-8a-[(E)-2-phenylethenyl]-2,3,4a,5,7,8-hexahydropyrano[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 139218034 |
| Molecular Formula | C29H29NO4S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | (4aR,8aR)-6-(4-methylphenyl)sulfonyl-2-phenyl-8a-[(E)-2-phenylethenyl]-2,3,4a,5,7,8-hexahydropyrano[3,2-c]pyridin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@]3(/C=C/c4ccccc4)OC(c4ccccc4)CC(=O)[C@@H]3C2)cc1 |
| InChI | InChI=1S/C29H29NO4S/c1-22-12-14-25(15-13-22)35(32,33)30-19-18-29(17-16-23-8-4-2-5-9-23)26(21-30)27(31)20-28(34-29)24-10-6-3-7-11-24/h2-17,26,28H,18-21H2,1H3/b17-16+/t26-,28?,29-/m0/s1 |
| InChIKey | OKCBGYQHZXNHLT-DNIQAIQTSA-N |
| XLogP | 5.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |