C20H20N2O3 — CID 139218182
(4'aS,10'bS)-9'-methoxyspiro[1H-indole-3,5'-2,3,4,4a,6,10b-hexahydropyrano[3,2-c]quinoline]-2-one (PubChem CID 139218182) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (4'aS,10'bS)-9'-methoxyspiro[1H-indole-3,5'-2,3,4,4a,6,10b-hexahydropyrano[3,2-c]quinoline]-2-one.
| Compound Name | (4'aS,10'bS)-9'-methoxyspiro[1H-indole-3,5'-2,3,4,4a,6,10b-hexahydropyrano[3,2-c]quinoline]-2-one |
|---|---|
| PubChem CID | 139218182 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (4'aS,10'bS)-9'-methoxyspiro[1H-indole-3,5'-2,3,4,4a,6,10b-hexahydropyrano[3,2-c]quinoline]-2-one |
| SMILES | COc1ccc2c(c1)[C@H]1OCCC[C@H]1C1(N2)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C20H20N2O3/c1-24-12-8-9-16-13(11-12)18-15(6-4-10-25-18)20(22-16)14-5-2-3-7-17(14)21-19(20)23/h2-3,5,7-9,11,15,18,22H,4,6,10H2,1H3,(H,21,23)/t15-,18-,20?/m1/s1 |
| InChIKey | BLXBUJBVXQNXNJ-ILPDQNMUSA-N |
| XLogP | 3.44 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|