About 5-fluoro-3'-(4-methoxyphenyl)spiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione
5-fluoro-3'-(4-methoxyphenyl)spiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione (PubChem CID 139218295) has the molecular formula C22H16FN3O3
and a molecular weight of 389.39 g/mol. Its IUPAC name is 5-fluoro-3'-(4-methoxyphenyl)spiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione.
Molecular Properties
| Compound Name | 5-fluoro-3'-(4-methoxyphenyl)spiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione |
| PubChem CID | 139218295 |
| Molecular Formula | C22H16FN3O3 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 5-fluoro-3'-(4-methoxyphenyl)spiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione |
| SMILES | COc1ccc(N2C(=O)c3ccccc3NC23C(=O)Nc2ccc(F)cc23)cc1 |
| InChI | InChI=1S/C22H16FN3O3/c1-29-15-9-7-14(8-10-15)26-20(27)16-4-2-3-5-18(16)25-22(26)17-12-13(23)6-11-19(17)24-21(22)28/h2-12,25H,1H3,(H,24,28) |
| InChIKey | BDJHBFDSVUDVSP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-3'-(4-methoxyphenyl)spiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3'-(4-methoxyphenyl)spiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione?
The IUPAC name of 5-fluoro-3'-(4-methoxyphenyl)spiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione (CID 139218295) is 5-fluoro-3'-(4-methoxyphenyl)spiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione.
What is the SMILES notation for 5-fluoro-3'-(4-methoxyphenyl)spiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione?
The canonical SMILES for 5-fluoro-3'-(4-methoxyphenyl)spiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione is COc1ccc(N2C(=O)c3ccccc3NC23C(=O)Nc2ccc(F)cc23)cc1.
What is the InChIKey of 5-fluoro-3'-(4-methoxyphenyl)spiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione?
The InChIKey is BDJHBFDSVUDVSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16FN3O3/c1-29-15-9-7-14(8-10-15)26-20(27)16-4-2-3-5-18(16)25-22(26)17-12-13(23)6-11-19(17)24-21(22)28/h2-12,25H,1H3,(H,24,28).
What are the key properties of 5-fluoro-3'-(4-methoxyphenyl)spiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione?
5-fluoro-3'-(4-methoxyphenyl)spiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione has a molecular weight of 389.39 g/mol, XLogP of 3.71, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3'-(4-methoxyphenyl)spiro[1H-indole-3,2'-1H-quinazoline]-2,4'-dione is sourced from PubChem (CID 139218295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).