C13H17N3O3S — CID 139218450
methyl (2E)-2-[3-[(E)-2-methylpropylideneamino]-5-oxo-2-prop-2-enylimino-1,3-thiazolidin-4-ylidene]acetate (PubChem CID 139218450) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is methyl (2E)-2-[3-[(E)-2-methylpropylideneamino]-5-oxo-2-prop-2-enylimino-1,3-thiazolidin-4-ylidene]acetate.
| Compound Name | methyl (2E)-2-[3-[(E)-2-methylpropylideneamino]-5-oxo-2-prop-2-enylimino-1,3-thiazolidin-4-ylidene]acetate |
|---|---|
| PubChem CID | 139218450 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | methyl (2E)-2-[3-[(E)-2-methylpropylideneamino]-5-oxo-2-prop-2-enylimino-1,3-thiazolidin-4-ylidene]acetate |
| SMILES | C=CC/N=C1\SC(=O)/C(=C\C(=O)OC)N1/N=C/C(C)C |
| InChI | InChI=1S/C13H17N3O3S/c1-5-6-14-13-16(15-8-9(2)3)10(12(18)20-13)7-11(17)19-4/h5,7-9H,1,6H2,2-4H3/b10-7+,14-13-,15-8+ |
| InChIKey | CSQQWILLFQBONW-DSJOGKGUSA-N |
| XLogP | 1.80 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|