C17H17N3O3S — CID 139218518
methyl 2-benzylimino-3-[(E)-[(E)-but-2-enylidene]amino]-4-oxo-1,3-thiazine-6-carboxylate (PubChem CID 139218518) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is methyl 2-benzylimino-3-[(E)-[(E)-but-2-enylidene]amino]-4-oxo-1,3-thiazine-6-carboxylate.
| Compound Name | methyl 2-benzylimino-3-[(E)-[(E)-but-2-enylidene]amino]-4-oxo-1,3-thiazine-6-carboxylate |
|---|---|
| PubChem CID | 139218518 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | methyl 2-benzylimino-3-[(E)-[(E)-but-2-enylidene]amino]-4-oxo-1,3-thiazine-6-carboxylate |
| SMILES | C/C=C/C=N/n1c(=O)cc(C(=O)OC)s/c1=N\Cc1ccccc1 |
| InChI | InChI=1S/C17H17N3O3S/c1-3-4-10-19-20-15(21)11-14(16(22)23-2)24-17(20)18-12-13-8-6-5-7-9-13/h3-11H,12H2,1-2H3/b4-3+,18-17-,19-10+ |
| InChIKey | ORWFKROBBUNUKK-IGRUPTBHSA-N |
| XLogP | 2.21 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|