About 6-methyl-3-([1,3,4]oxadiazino[6,5-b]indol-3-yl)chromen-2-one
6-methyl-3-([1,3,4]oxadiazino[6,5-b]indol-3-yl)chromen-2-one (PubChem CID 139218793) has the molecular formula C19H11N3O3
and a molecular weight of 329.32 g/mol. Its IUPAC name is 6-methyl-3-([1,3,4]oxadiazino[6,5-b]indol-3-yl)chromen-2-one.
Molecular Properties
| Compound Name | 6-methyl-3-([1,3,4]oxadiazino[6,5-b]indol-3-yl)chromen-2-one |
| PubChem CID | 139218793 |
| Molecular Formula | C19H11N3O3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 6-methyl-3-([1,3,4]oxadiazino[6,5-b]indol-3-yl)chromen-2-one |
| SMILES | Cc1ccc2oc(=O)c(-c3nnc4c5ccccc5nc-4o3)cc2c1 |
| InChI | InChI=1S/C19H11N3O3/c1-10-6-7-15-11(8-10)9-13(19(23)24-15)17-22-21-16-12-4-2-3-5-14(12)20-18(16)25-17/h2-9H,1H3 |
| InChIKey | QGGSUJPXEJHBFM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 82.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-3-([1,3,4]oxadiazino[6,5-b]indol-3-yl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-([1,3,4]oxadiazino[6,5-b]indol-3-yl)chromen-2-one?
The IUPAC name of 6-methyl-3-([1,3,4]oxadiazino[6,5-b]indol-3-yl)chromen-2-one (CID 139218793) is 6-methyl-3-([1,3,4]oxadiazino[6,5-b]indol-3-yl)chromen-2-one.
What is the SMILES notation for 6-methyl-3-([1,3,4]oxadiazino[6,5-b]indol-3-yl)chromen-2-one?
The canonical SMILES for 6-methyl-3-([1,3,4]oxadiazino[6,5-b]indol-3-yl)chromen-2-one is Cc1ccc2oc(=O)c(-c3nnc4c5ccccc5nc-4o3)cc2c1.
What is the InChIKey of 6-methyl-3-([1,3,4]oxadiazino[6,5-b]indol-3-yl)chromen-2-one?
The InChIKey is QGGSUJPXEJHBFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11N3O3/c1-10-6-7-15-11(8-10)9-13(19(23)24-15)17-22-21-16-12-4-2-3-5-14(12)20-18(16)25-17/h2-9H,1H3.
What are the key properties of 6-methyl-3-([1,3,4]oxadiazino[6,5-b]indol-3-yl)chromen-2-one?
6-methyl-3-([1,3,4]oxadiazino[6,5-b]indol-3-yl)chromen-2-one has a molecular weight of 329.32 g/mol, XLogP of 3.80, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-([1,3,4]oxadiazino[6,5-b]indol-3-yl)chromen-2-one is sourced from PubChem (CID 139218793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).