About [2-oxo-2-(4-phenylphenyl)ethyl] N-(5-methyl-1H-pyrazol-3-yl)-N'-prop-2-enylcarbamimidothioate
[2-oxo-2-(4-phenylphenyl)ethyl] N-(5-methyl-1H-pyrazol-3-yl)-N'-prop-2-enylcarbamimidothioate (PubChem CID 139219033) has the molecular formula C22H22N4OS
and a molecular weight of 390.51 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] N-(5-methyl-1H-pyrazol-3-yl)-N'-prop-2-enylcarbamimidothioate.
Molecular Properties
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] N-(5-methyl-1H-pyrazol-3-yl)-N'-prop-2-enylcarbamimidothioate |
| PubChem CID | 139219033 |
| Molecular Formula | C22H22N4OS |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] N-(5-methyl-1H-pyrazol-3-yl)-N'-prop-2-enylcarbamimidothioate |
| SMILES | C=CC/N=C(/Nc1cc(C)[nH]n1)SCC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N4OS/c1-3-13-23-22(24-21-14-16(2)25-26-21)28-15-20(27)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h3-12,14H,1,13,15H2,2H3,(H2,23,24,25,26) |
| InChIKey | CCRJBEDFFMLXIQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(4-phenylphenyl)ethyl] N-(5-methyl-1H-pyrazol-3-yl)-N'-prop-2-enylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(4-phenylphenyl)ethyl] N-(5-methyl-1H-pyrazol-3-yl)-N'-prop-2-enylcarbamimidothioate?
The IUPAC name of [2-oxo-2-(4-phenylphenyl)ethyl] N-(5-methyl-1H-pyrazol-3-yl)-N'-prop-2-enylcarbamimidothioate (CID 139219033) is [2-oxo-2-(4-phenylphenyl)ethyl] N-(5-methyl-1H-pyrazol-3-yl)-N'-prop-2-enylcarbamimidothioate.
What is the SMILES notation for [2-oxo-2-(4-phenylphenyl)ethyl] N-(5-methyl-1H-pyrazol-3-yl)-N'-prop-2-enylcarbamimidothioate?
The canonical SMILES for [2-oxo-2-(4-phenylphenyl)ethyl] N-(5-methyl-1H-pyrazol-3-yl)-N'-prop-2-enylcarbamimidothioate is C=CC/N=C(/Nc1cc(C)[nH]n1)SCC(=O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of [2-oxo-2-(4-phenylphenyl)ethyl] N-(5-methyl-1H-pyrazol-3-yl)-N'-prop-2-enylcarbamimidothioate?
The InChIKey is CCRJBEDFFMLXIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4OS/c1-3-13-23-22(24-21-14-16(2)25-26-21)28-15-20(27)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h3-12,14H,1,13,15H2,2H3,(H2,23,24,25,26).
What are the key properties of [2-oxo-2-(4-phenylphenyl)ethyl] N-(5-methyl-1H-pyrazol-3-yl)-N'-prop-2-enylcarbamimidothioate?
[2-oxo-2-(4-phenylphenyl)ethyl] N-(5-methyl-1H-pyrazol-3-yl)-N'-prop-2-enylcarbamimidothioate has a molecular weight of 390.51 g/mol, XLogP of 4.96, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(4-phenylphenyl)ethyl] N-(5-methyl-1H-pyrazol-3-yl)-N'-prop-2-enylcarbamimidothioate is sourced from PubChem (CID 139219033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).