C27H27NO4 — CID 139219052
6-benzyl-4a-ethyl-7a-hydroxy-3,3-diphenyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one (PubChem CID 139219052) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 6-benzyl-4a-ethyl-7a-hydroxy-3,3-diphenyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one.
| Compound Name | 6-benzyl-4a-ethyl-7a-hydroxy-3,3-diphenyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one |
|---|---|
| PubChem CID | 139219052 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 6-benzyl-4a-ethyl-7a-hydroxy-3,3-diphenyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one |
| SMILES | CCC12CC(c3ccccc3)(c3ccccc3)OOC1(O)CN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C27H27NO4/c1-2-25-19-26(22-14-8-4-9-15-22,23-16-10-5-11-17-23)31-32-27(25,30)20-28(24(25)29)18-21-12-6-3-7-13-21/h3-17,30H,2,18-20H2,1H3 |
| InChIKey | MOPYUYVWICPGOV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|