C29H31NO4 — CID 139219054
6-benzyl-4a-butyl-7a-hydroxy-3,3-diphenyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one (PubChem CID 139219054) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is 6-benzyl-4a-butyl-7a-hydroxy-3,3-diphenyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one.
| Compound Name | 6-benzyl-4a-butyl-7a-hydroxy-3,3-diphenyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one |
|---|---|
| PubChem CID | 139219054 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 6-benzyl-4a-butyl-7a-hydroxy-3,3-diphenyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one |
| SMILES | CCCCC12CC(c3ccccc3)(c3ccccc3)OOC1(O)CN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C29H31NO4/c1-2-3-19-27-21-28(24-15-9-5-10-16-24,25-17-11-6-12-18-25)33-34-29(27,32)22-30(26(27)31)20-23-13-7-4-8-14-23/h4-18,32H,2-3,19-22H2,1H3 |
| InChIKey | NVEYDYAPFKARMK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|