C24H29NO4 — CID 139219061
6-butyl-4a-ethyl-7a-hydroxy-3,3-diphenyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one (PubChem CID 139219061) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 6-butyl-4a-ethyl-7a-hydroxy-3,3-diphenyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one.
| Compound Name | 6-butyl-4a-ethyl-7a-hydroxy-3,3-diphenyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one |
|---|---|
| PubChem CID | 139219061 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 6-butyl-4a-ethyl-7a-hydroxy-3,3-diphenyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one |
| SMILES | CCCCN1CC2(O)OOC(c3ccccc3)(c3ccccc3)CC2(CC)C1=O |
| InChI | InChI=1S/C24H29NO4/c1-3-5-16-25-18-24(27)22(4-2,21(25)26)17-23(28-29-24,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,27H,3-5,16-18H2,1-2H3 |
| InChIKey | ZBCIQPHAZSOKGW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|