C28H29NO4 — CID 139219069
6-benzyl-7a-hydroxy-4a-methyl-3,3-bis(4-methylphenyl)-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one (PubChem CID 139219069) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is 6-benzyl-7a-hydroxy-4a-methyl-3,3-bis(4-methylphenyl)-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one.
| Compound Name | 6-benzyl-7a-hydroxy-4a-methyl-3,3-bis(4-methylphenyl)-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one |
|---|---|
| PubChem CID | 139219069 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 6-benzyl-7a-hydroxy-4a-methyl-3,3-bis(4-methylphenyl)-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)CC3(C)C(=O)N(Cc4ccccc4)CC3(O)OO2)cc1 |
| InChI | InChI=1S/C28H29NO4/c1-20-9-13-23(14-10-20)27(24-15-11-21(2)12-16-24)18-26(3)25(30)29(19-28(26,31)33-32-27)17-22-7-5-4-6-8-22/h4-16,31H,17-19H2,1-3H3 |
| InChIKey | FUBKVOBLBMRDEW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|