C26H23F2NO4 — CID 139219072
6-benzyl-3,3-bis(4-fluorophenyl)-7a-hydroxy-4a-methyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one (PubChem CID 139219072) has the molecular formula C26H23F2NO4 and a molecular weight of 451.47 g/mol. Its IUPAC name is 6-benzyl-3,3-bis(4-fluorophenyl)-7a-hydroxy-4a-methyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one.
| Compound Name | 6-benzyl-3,3-bis(4-fluorophenyl)-7a-hydroxy-4a-methyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one |
|---|---|
| PubChem CID | 139219072 |
| Molecular Formula | C26H23F2NO4 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 6-benzyl-3,3-bis(4-fluorophenyl)-7a-hydroxy-4a-methyl-4,7-dihydro-[1,2]dioxino[3,4-c]pyrrol-5-one |
| SMILES | CC12CC(c3ccc(F)cc3)(c3ccc(F)cc3)OOC1(O)CN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C26H23F2NO4/c1-24-16-25(19-7-11-21(27)12-8-19,20-9-13-22(28)14-10-20)32-33-26(24,31)17-29(23(24)30)15-18-5-3-2-4-6-18/h2-14,31H,15-17H2,1H3 |
| InChIKey | MZTYNRNBXKRMPU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|