C12H9ClN6OSSe — CID 139219834
2-[4-(3-chlorophenyl)selenadiazol-5-yl]sulfanyl-N-(1H-1,2,4-triazol-5-yl)acetamide (PubChem CID 139219834) has the molecular formula C12H9ClN6OSSe and a molecular weight of 399.73 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)selenadiazol-5-yl]sulfanyl-N-(1H-1,2,4-triazol-5-yl)acetamide.
| Compound Name | 2-[4-(3-chlorophenyl)selenadiazol-5-yl]sulfanyl-N-(1H-1,2,4-triazol-5-yl)acetamide |
|---|---|
| PubChem CID | 139219834 |
| Molecular Formula | C12H9ClN6OSSe |
| Molecular Weight | 399.73 g/mol |
| Exact Mass | 399.94 |
| IUPAC Name | 2-[4-(3-chlorophenyl)selenadiazol-5-yl]sulfanyl-N-(1H-1,2,4-triazol-5-yl)acetamide |
| SMILES | O=C(CSc1[se]nnc1-c1cccc(Cl)c1)Nc1ncn[nH]1 |
| InChI | InChI=1S/C12H9ClN6OSSe/c13-8-3-1-2-7(4-8)10-11(22-19-17-10)21-5-9(20)16-12-14-6-15-18-12/h1-4,6H,5H2,(H2,14,15,16,18,20) |
| InChIKey | AKRVUDQADCJLAP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.73 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|