C12H9N7O3SSe — CID 139219835
2-[4-(3-nitrophenyl)selenadiazol-5-yl]sulfanyl-N-(1H-1,2,4-triazol-5-yl)acetamide (PubChem CID 139219835) has the molecular formula C12H9N7O3SSe and a molecular weight of 410.28 g/mol. Its IUPAC name is 2-[4-(3-nitrophenyl)selenadiazol-5-yl]sulfanyl-N-(1H-1,2,4-triazol-5-yl)acetamide.
| Compound Name | 2-[4-(3-nitrophenyl)selenadiazol-5-yl]sulfanyl-N-(1H-1,2,4-triazol-5-yl)acetamide |
|---|---|
| PubChem CID | 139219835 |
| Molecular Formula | C12H9N7O3SSe |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 410.97 |
| IUPAC Name | 2-[4-(3-nitrophenyl)selenadiazol-5-yl]sulfanyl-N-(1H-1,2,4-triazol-5-yl)acetamide |
| SMILES | O=C(CSc1[se]nnc1-c1cccc([N+](=O)[O-])c1)Nc1ncn[nH]1 |
| InChI | InChI=1S/C12H9N7O3SSe/c20-9(15-12-13-6-14-17-12)5-23-11-10(16-18-24-11)7-2-1-3-8(4-7)19(21)22/h1-4,6H,5H2,(H2,13,14,15,17,20) |
| InChIKey | SYFAMJWVRUJGNR-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|