C44H46N4O4S2 — CID 139219876
(Z)-1-[4-[6-[4-[(Z)-1-hydroxy-3-(2-phenylhydrazinyl)-3-thiophen-2-ylprop-1-enyl]phenoxy]hexoxy]phenyl]-3-(2-phenylhydrazinyl)-3-thiophen-2-ylprop-1-en-1-ol (PubChem CID 139219876) has the molecular formula C44H46N4O4S2 and a molecular weight of 759.01 g/mol. Its IUPAC name is (Z)-1-[4-[6-[4-[(Z)-1-hydroxy-3-(2-phenylhydrazinyl)-3-thiophen-2-ylprop-1-enyl]phenoxy]hexoxy]phenyl]-3-(2-phenylhydrazinyl)-3-thiophen-2-ylprop-1-en-1-ol.
| Compound Name | (Z)-1-[4-[6-[4-[(Z)-1-hydroxy-3-(2-phenylhydrazinyl)-3-thiophen-2-ylprop-1-enyl]phenoxy]hexoxy]phenyl]-3-(2-phenylhydrazinyl)-3-thiophen-2-ylprop-1-en-1-ol |
|---|---|
| PubChem CID | 139219876 |
| Molecular Formula | C44H46N4O4S2 |
| Molecular Weight | 759.01 g/mol |
| Exact Mass | 758.30 |
| IUPAC Name | (Z)-1-[4-[6-[4-[(Z)-1-hydroxy-3-(2-phenylhydrazinyl)-3-thiophen-2-ylprop-1-enyl]phenoxy]hexoxy]phenyl]-3-(2-phenylhydrazinyl)-3-thiophen-2-ylprop-1-en-1-ol |
| SMILES | O/C(=C\C(NNc1ccccc1)c1cccs1)c1ccc(OCCCCCCOc2ccc(/C(O)=C/C(NNc3ccccc3)c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C44H46N4O4S2/c49-41(31-39(43-17-11-29-53-43)47-45-35-13-5-3-6-14-35)33-19-23-37(24-20-33)51-27-9-1-2-10-28-52-38-25-21-34(22-26-38)42(50)32-40(44-18-12-30-54-44)48-46-36-15-7-4-8-16-36/h3-8,11-26,29-32,39-40,45-50H,1-2,9-10,27-28H2/b41-31-,42-32- |
| InChIKey | RJLZVWDWGSQLSF-CMRZERMZSA-N |
| XLogP | 11.34 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.01 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|