C46H50N4O4S2 — CID 139219913
(E)-1-[4-[8-[4-[(E)-1-hydroxy-1-(2-phenylhydrazinyl)-3-thiophen-2-ylprop-2-enyl]phenoxy]octoxy]phenyl]-1-(2-phenylhydrazinyl)-3-thiophen-2-ylprop-2-en-1-ol (PubChem CID 139219913) has the molecular formula C46H50N4O4S2 and a molecular weight of 787.06 g/mol. Its IUPAC name is (E)-1-[4-[8-[4-[(E)-1-hydroxy-1-(2-phenylhydrazinyl)-3-thiophen-2-ylprop-2-enyl]phenoxy]octoxy]phenyl]-1-(2-phenylhydrazinyl)-3-thiophen-2-ylprop-2-en-1-ol.
| Compound Name | (E)-1-[4-[8-[4-[(E)-1-hydroxy-1-(2-phenylhydrazinyl)-3-thiophen-2-ylprop-2-enyl]phenoxy]octoxy]phenyl]-1-(2-phenylhydrazinyl)-3-thiophen-2-ylprop-2-en-1-ol |
|---|---|
| PubChem CID | 139219913 |
| Molecular Formula | C46H50N4O4S2 |
| Molecular Weight | 787.06 g/mol |
| Exact Mass | 786.33 |
| IUPAC Name | (E)-1-[4-[8-[4-[(E)-1-hydroxy-1-(2-phenylhydrazinyl)-3-thiophen-2-ylprop-2-enyl]phenoxy]octoxy]phenyl]-1-(2-phenylhydrazinyl)-3-thiophen-2-ylprop-2-en-1-ol |
| SMILES | OC(/C=C/c1cccs1)(NNc1ccccc1)c1ccc(OCCCCCCCCOc2ccc(C(O)(/C=C/c3cccs3)NNc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C46H50N4O4S2/c51-45(31-29-43-19-13-35-55-43,49-47-39-15-7-5-8-16-39)37-21-25-41(26-22-37)53-33-11-3-1-2-4-12-34-54-42-27-23-38(24-28-42)46(52,32-30-44-20-14-36-56-44)50-48-40-17-9-6-10-18-40/h5-10,13-32,35-36,47-52H,1-4,11-12,33-34H2/b31-29+,32-30+ |
| InChIKey | AHUZFYJLPRHOGE-JWTBXLROSA-N |
| XLogP | 10.56 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.06 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|