C22H24N2 — CID 139220037
2,3,3-trimethyl-5-(2,3,3-trimethylindol-5-yl)indole (PubChem CID 139220037) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 2,3,3-trimethyl-5-(2,3,3-trimethylindol-5-yl)indole.
| Compound Name | 2,3,3-trimethyl-5-(2,3,3-trimethylindol-5-yl)indole |
|---|---|
| PubChem CID | 139220037 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2,3,3-trimethyl-5-(2,3,3-trimethylindol-5-yl)indole |
| SMILES | CC1=Nc2ccc(-c3ccc4c(c3)C(C)(C)C(C)=N4)cc2C1(C)C |
| InChI | InChI=1S/C22H24N2/c1-13-21(3,4)17-11-15(7-9-19(17)23-13)16-8-10-20-18(12-16)22(5,6)14(2)24-20/h7-12H,1-6H3 |
| InChIKey | HFIGWPLGABXLQO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |