C17H14N4O2 — CID 139220044
6-(3,3-dimethylindol-2-yl)-1H-pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 139220044) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 6-(3,3-dimethylindol-2-yl)-1H-pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 6-(3,3-dimethylindol-2-yl)-1H-pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139220044 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 6-(3,3-dimethylindol-2-yl)-1H-pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CC1(C)C(c2cnc3[nH]c(=O)[nH]c(=O)c3c2)=Nc2ccccc21 |
| InChI | InChI=1S/C17H14N4O2/c1-17(2)11-5-3-4-6-12(11)19-13(17)9-7-10-14(18-8-9)20-16(23)21-15(10)22/h3-8H,1-2H3,(H2,18,20,21,22,23) |
| InChIKey | WADKUNPOJFQJNF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |