C19H30O2 — CID 139220157
2,2-dibutyl-4,7-dimethoxy-1,3-dihydroindene (PubChem CID 139220157) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2,2-dibutyl-4,7-dimethoxy-1,3-dihydroindene.
| Compound Name | 2,2-dibutyl-4,7-dimethoxy-1,3-dihydroindene |
|---|---|
| PubChem CID | 139220157 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2,2-dibutyl-4,7-dimethoxy-1,3-dihydroindene |
| SMILES | CCCCC1(CCCC)Cc2c(OC)ccc(OC)c2C1 |
| InChI | InChI=1S/C19H30O2/c1-5-7-11-19(12-8-6-2)13-15-16(14-19)18(21-4)10-9-17(15)20-3/h9-10H,5-8,11-14H2,1-4H3 |
| InChIKey | PAYBIINSTUQHNF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |